ANSWERS TO CHM 104 TEST

TYPE B: ANSWERS TO CHM 104 (INTRODUCTION TO ORGANIC CHEMISTRY) TEST 1a). Alcohols have higher boiling points compared to hydrocarbons of similar molecular weight due to HYDROGEN BONDING 1b). CH3CH2CH(CH3)OH is a SECONDARY alcohol. 1c). Primary, secondary and tertiary alcohols can be differentiated by use of LUCAS reagent 1d).Give the structure of 2-chloro-3-methyl heptanol CH3CH2CH2CH2CH(CH3)CHClCH2OH 1e).Alcohols add to aldehydes to yield ACETALS 2a).Carbon centre to which four different groups are attached is called CHIRAL CENTRE 2b). The group -RNH2 represents AMINE 2c).Staggered conformation is a type of conformation in which the atoms or groups attached to carbon-carbon atom are FAR APART 2d).The phenomenon where a compound has the ability to exist with the same molecular formula but different structural formula is known as ISOMERISM 2e).Write the structure of cis-but-2-ene

3a). Give the IUPAC names of this compound; CH3 CHOHCH2 OH 1,2-PROPANDIOL or PROPAN-1,2-DIOL 3b).Organic compounds can be sourced through PLANTS and ANIMALS 3c).Write the structure of 2-fluoro-2-methylpropane 3d).Overlapping of sp3 hybrid orbitals gives rise to the formation of SINGLE/SIGMA BOND or ALKANES 3e).The bond angle for sp3 hybrid orbitals is 1090 TYPE A: ANSWERS TO CHM 104 (INTRODUCTION TO ORGANIC CHEMISTRY) TEST 1a). Orbital having the same principal quantum number and energy are called DEGENERATE ORBITALS b). Why is carbon atom, the central atom in which the chemistry of life and process evolve? This is due to STRUCTURE OF CARBON ATOM c). Give the IUPAC names of this compound CH3CH2CH=CHCH2CHCH3 CH3 6-methylhept-3-ene d). Organic compounds can be classified into CYCLIC and ACYCLIC e). MANUFACTURE of DYES and COSMETICS are the importance of organic chemistry. Also, understanding life processes, in clothing or textile, drugs, paper, explosives and fuel. 2a). CH3CH(CH3)CH2OH is a PRIMARY alcohol. b). Alcohols add to aldehydes to yield ACETALS c).CH3CH2CH2NH2 is named as ¬¬¬¬¬¬¬¬¬¬¬¬PROPANAMINE 2d). Aldehydes can be differentiated from ketones by use of SCHIFF or TOLLEN’S REAGENT 2e). LiAlH4 and NaBH4 are examples of reducing agents used in reducing organic compounds. 3a). Alkynes have a general formula of CnH2n-2 3b).What is the functional group of carboxylic acid RCOOH 3c).Trans-1,2-dichloroethene can be represented as

3d). A type of structural isomer in which the compound has the same molecular formula but different functional group is called FUNCTIONAL GROUP ISOMER 3e). Stereoisomers can be sub-divided into GEOMETRIC and OPTICAL STEREOISOMERS